C33H37N3S2+2 — CID 157334951
4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[3-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]propyldisulfanyl]ethyl]aniline (PubChem CID 157334951) has the molecular formula C33H37N3S2+2 and a molecular weight of 539.81 g/mol. Its IUPAC name is 4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[3-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]propyldisulfanyl]ethyl]aniline.
| Compound Name | 4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[3-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]propyldisulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 157334951 |
| Molecular Formula | C33H37N3S2+2 |
| Molecular Weight | 539.81 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[3-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]propyldisulfanyl]ethyl]aniline |
| SMILES | C[n+]1ccc(/C=C/c2ccc(CCCSSCCNc3ccc(/C=C/c4cc[n+](C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H36N3S2/c1-35-22-17-31(18-23-35)11-9-29-7-5-28(6-8-29)4-3-26-37-38-27-21-34-33-15-13-30(14-16-33)10-12-32-19-24-36(2)25-20-32/h5-20,22-25H,3-4,21,26-27H2,1-2H3/q+1/p+1/b11-9+ |
| InChIKey | SCHSJCZYCFUXAY-PKNBQFBNSA-O |
| XLogP | 7.10 |
| TPSA | 19.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.81 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|