C46H53N4S2+ — CID 163462574
4-[5-(benzylamino)-3-ethylidenehex-4-enyl]-N-[2-[2-[4-[2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline (PubChem CID 163462574) has the molecular formula C46H53N4S2+ and a molecular weight of 726.09 g/mol. Its IUPAC name is 4-[5-(benzylamino)-3-ethylidenehex-4-enyl]-N-[2-[2-[4-[2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline.
| Compound Name | 4-[5-(benzylamino)-3-ethylidenehex-4-enyl]-N-[2-[2-[4-[2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 163462574 |
| Molecular Formula | C46H53N4S2+ |
| Molecular Weight | 726.09 g/mol |
| Exact Mass | 725.37 |
| IUPAC Name | 4-[5-(benzylamino)-3-ethylidenehex-4-enyl]-N-[2-[2-[4-[2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
| SMILES | CC=C(C=C(C)NCc1ccccc1)CCc1ccc(NCCSSCCNc2ccc(C=Cc3cc[n+](Cc4ccccc4)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C46H52N4S2/c1-4-39(33-37(2)49-35-43-11-7-5-8-12-43)15-16-40-19-23-45(24-20-40)47-28-31-51-52-32-29-48-46-25-21-41(22-26-46)17-18-42-27-30-50(38(3)34-42)36-44-13-9-6-10-14-44/h4-14,17-27,30,33-34,47,49H,15-16,28-29,31-32,35-36H2,1-3H3/p+1 |
| InChIKey | BPWCHGHSMUEXSZ-UHFFFAOYSA-O |
| XLogP | 10.98 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.09 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|