C32H36N4S2+2 — CID 76595629
4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[2-[4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline (PubChem CID 76595629) has the molecular formula C32H36N4S2+2 and a molecular weight of 540.80 g/mol. Its IUPAC name is 4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[2-[4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline.
| Compound Name | 4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[2-[4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 76595629 |
| Molecular Formula | C32H36N4S2+2 |
| Molecular Weight | 540.80 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[2-[4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
| SMILES | C[n+]1ccc(C=Cc2ccc(NCCSSCCNc3ccc(C=Cc4cc[n+](C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H34N4S2/c1-35-21-15-29(16-22-35)5-3-27-7-11-31(12-8-27)33-19-25-37-38-26-20-34-32-13-9-28(10-14-32)4-6-30-17-23-36(2)24-18-30/h3-18,21-24H,19-20,25-26H2,1-2H3/p+2 |
| InChIKey | MSAATAKBFRMTEA-UHFFFAOYSA-P |
| XLogP | 6.58 |
| TPSA | 31.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.80 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|