C46H54N4S2+2 — CID 163462573
benzyl-[4-[2-[4-[2-[2-[4-[2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethylamino]phenyl]ethyl]hexa-2,4-dien-2-yl]azanium (PubChem CID 163462573) has the molecular formula C46H54N4S2+2 and a molecular weight of 727.10 g/mol. Its IUPAC name is benzyl-[4-[2-[4-[2-[2-[4-[2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethylamino]phenyl]ethyl]hexa-2,4-dien-2-yl]azanium.
| Compound Name | benzyl-[4-[2-[4-[2-[2-[4-[2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethylamino]phenyl]ethyl]hexa-2,4-dien-2-yl]azanium |
|---|---|
| PubChem CID | 163462573 |
| Molecular Formula | C46H54N4S2+2 |
| Molecular Weight | 727.10 g/mol |
| Exact Mass | 726.38 |
| IUPAC Name | benzyl-[4-[2-[4-[2-[2-[4-[2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethylamino]phenyl]ethyl]hexa-2,4-dien-2-yl]azanium |
| SMILES | CC=C(C=C(C)[NH2+]Cc1ccccc1)CCc1ccc(NCCSSCCNc2ccc(C=Cc3cc[n+](Cc4ccccc4)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C46H52N4S2/c1-4-39(33-37(2)49-35-43-11-7-5-8-12-43)15-16-40-19-23-45(24-20-40)47-28-31-51-52-32-29-48-46-25-21-41(22-26-46)17-18-42-27-30-50(38(3)34-42)36-44-13-9-6-10-14-44/h4-14,17-27,30,33-34,47,49H,15-16,28-29,31-32,35-36H2,1-3H3/p+2 |
| InChIKey | BPWCHGHSMUEXSZ-UHFFFAOYSA-P |
| XLogP | 9.95 |
| TPSA | 44.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.10 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|