C45H48N4S2+2 — CID 143546597
4-[(E)-2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[2-[4-[(E)-2-(1-benzyl-5-methyl-1H-pyrrol-1-ium-3-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline (PubChem CID 143546597) has the molecular formula C45H48N4S2+2 and a molecular weight of 709.04 g/mol. Its IUPAC name is 4-[(E)-2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[2-[4-[(E)-2-(1-benzyl-5-methyl-1H-pyrrol-1-ium-3-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline.
| Compound Name | 4-[(E)-2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[2-[4-[(E)-2-(1-benzyl-5-methyl-1H-pyrrol-1-ium-3-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 143546597 |
| Molecular Formula | C45H48N4S2+2 |
| Molecular Weight | 709.04 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | 4-[(E)-2-(1-benzyl-2-methylpyridin-1-ium-4-yl)ethenyl]-N-[2-[2-[4-[(E)-2-(1-benzyl-5-methyl-1H-pyrrol-1-ium-3-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
| SMILES | CC1=CC(/C=C/c2ccc(NCCSSCCNc3ccc(/C=C/c4cc[n+](Cc5ccccc5)c(C)c4)cc3)cc2)=C[NH+]1Cc1ccccc1 |
| InChI | InChI=1S/C45H46N4S2/c1-36-31-40(25-28-48(36)33-41-9-5-3-6-10-41)15-13-38-17-21-44(22-18-38)46-26-29-50-51-30-27-47-45-23-19-39(20-24-45)14-16-43-32-37(2)49(35-43)34-42-11-7-4-8-12-42/h3-25,28,31-32,35,47H,26-27,29-30,33-34H2,1-2H3/p+2/b16-14+ |
| InChIKey | QUCSGRTYYYIDLL-JQIJEIRASA-P |
| XLogP | 9.31 |
| TPSA | 32.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.04 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|