C35H41N3S2+2 — CID 157334954
4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-[2-[3-[4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]phenyl]propyldisulfanyl]ethyl]aniline (PubChem CID 157334954) has the molecular formula C35H41N3S2+2 and a molecular weight of 567.87 g/mol. Its IUPAC name is 4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-[2-[3-[4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]phenyl]propyldisulfanyl]ethyl]aniline.
| Compound Name | 4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-[2-[3-[4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]phenyl]propyldisulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 157334954 |
| Molecular Formula | C35H41N3S2+2 |
| Molecular Weight | 567.87 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-[2-[3-[4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]phenyl]propyldisulfanyl]ethyl]aniline |
| SMILES | CC[n+]1ccc(/C=C/c2ccc(CCCSSCCNc3ccc(/C=C/c4cc[n+](CC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H40N3S2/c1-3-37-24-19-33(20-25-37)13-11-31-9-7-30(8-10-31)6-5-28-39-40-29-23-36-35-17-15-32(16-18-35)12-14-34-21-26-38(4-2)27-22-34/h7-22,24-27H,3-6,23,28-29H2,1-2H3/q+1/p+1/b13-11+ |
| InChIKey | DCJLUVDIDPKXFS-ACCUITESSA-O |
| XLogP | 8.07 |
| TPSA | 19.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.87 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|