C22H18Br4N2+2 — CID 11506100
1-methyl-4-[(E)-2-[2,3,5,6-tetrabromo-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]ethenyl]pyridin-1-ium (PubChem CID 11506100) has the molecular formula C22H18Br4N2+2 and a molecular weight of 630.02 g/mol. Its IUPAC name is 1-methyl-4-[(E)-2-[2,3,5,6-tetrabromo-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]ethenyl]pyridin-1-ium.
| Compound Name | 1-methyl-4-[(E)-2-[2,3,5,6-tetrabromo-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]ethenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 11506100 |
| Molecular Formula | C22H18Br4N2+2 |
| Molecular Weight | 630.02 g/mol |
| Exact Mass | 625.82 |
| IUPAC Name | 1-methyl-4-[(E)-2-[2,3,5,6-tetrabromo-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]ethenyl]pyridin-1-ium |
| SMILES | C[n+]1ccc(/C=C/c2c(Br)c(Br)c(/C=C/c3cc[n+](C)cc3)c(Br)c2Br)cc1 |
| InChI | InChI=1S/C22H18Br4N2/c1-27-11-7-15(8-12-27)3-5-17-19(23)21(25)18(22(26)20(17)24)6-4-16-9-13-28(2)14-10-16/h3-14H,1-2H3/q+2/b5-3+,6-4+ |
| InChIKey | YBFPGTPBOZFSMV-GGWOSOGESA-N |
| XLogP | 6.73 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.02 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|