C19H18N+ — CID 102165124
4-[(E)-2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethenyl]-1-methylpyridin-1-ium (PubChem CID 102165124) has the molecular formula C19H18N+ and a molecular weight of 260.36 g/mol. Its IUPAC name is 4-[(E)-2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethenyl]-1-methylpyridin-1-ium.
| Compound Name | 4-[(E)-2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 102165124 |
| Molecular Formula | C19H18N+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-[(E)-2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethenyl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1ccc(/C=C/c2ccc(C3C=CC=C3)cc2)cc1 |
| InChI | InChI=1S/C19H18N/c1-20-14-12-17(13-15-20)7-6-16-8-10-19(11-9-16)18-4-2-3-5-18/h2-15,18H,1H3/q+1/b7-6+ |
| InChIKey | HRESHVWKXAVNKZ-VOTSOKGWSA-N |
| XLogP | 3.89 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|