C22H26N2 — CID 142848674
(2Z,4E)-N-benzyl-5-methyl-2-(methylideneamino)-7-phenylhepta-2,4-dien-4-amine (PubChem CID 142848674) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2Z,4E)-N-benzyl-5-methyl-2-(methylideneamino)-7-phenylhepta-2,4-dien-4-amine.
| Compound Name | (2Z,4E)-N-benzyl-5-methyl-2-(methylideneamino)-7-phenylhepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 142848674 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (2Z,4E)-N-benzyl-5-methyl-2-(methylideneamino)-7-phenylhepta-2,4-dien-4-amine |
| SMILES | C=N/C(C)=C\C(NCc1ccccc1)=C(\C)CCc1ccccc1 |
| InChI | InChI=1S/C22H26N2/c1-18(14-15-20-10-6-4-7-11-20)22(16-19(2)23-3)24-17-21-12-8-5-9-13-21/h4-13,16,24H,3,14-15,17H2,1-2H3/b19-16-,22-18+ |
| InChIKey | OHNOPTIYYSGQGW-MLYOQPAASA-N |
| XLogP | 5.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|