C24H26N2 — CID 144690757
(Z)-N-benzyl-2-(methylideneamino)-1,2-diphenylethenamine;ethane (PubChem CID 144690757) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (Z)-N-benzyl-2-(methylideneamino)-1,2-diphenylethenamine;ethane.
| Compound Name | (Z)-N-benzyl-2-(methylideneamino)-1,2-diphenylethenamine;ethane |
|---|---|
| PubChem CID | 144690757 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (Z)-N-benzyl-2-(methylideneamino)-1,2-diphenylethenamine;ethane |
| SMILES | C=N/C(=C(\NCc1ccccc1)c1ccccc1)c1ccccc1.CC |
| InChI | InChI=1S/C22H20N2.C2H6/c1-23-21(19-13-7-3-8-14-19)22(20-15-9-4-10-16-20)24-17-18-11-5-2-6-12-18;1-2/h2-16,24H,1,17H2;1-2H3/b22-21-; |
| InChIKey | KDVYEQNPRJPRSU-SVXKRPBISA-N |
| XLogP | 6.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|