C27H26F3NO — CID 166174337
(E)-1-(benzylamino)-2-phenyl-1-[4-(trifluoromethyl)phenyl]hept-1-en-3-one (PubChem CID 166174337) has the molecular formula C27H26F3NO and a molecular weight of 437.51 g/mol. Its IUPAC name is (E)-1-(benzylamino)-2-phenyl-1-[4-(trifluoromethyl)phenyl]hept-1-en-3-one.
| Compound Name | (E)-1-(benzylamino)-2-phenyl-1-[4-(trifluoromethyl)phenyl]hept-1-en-3-one |
|---|---|
| PubChem CID | 166174337 |
| Molecular Formula | C27H26F3NO |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (E)-1-(benzylamino)-2-phenyl-1-[4-(trifluoromethyl)phenyl]hept-1-en-3-one |
| SMILES | CCCCC(=O)/C(=C(/NCc1ccccc1)c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H26F3NO/c1-2-3-14-24(32)25(21-12-8-5-9-13-21)26(31-19-20-10-6-4-7-11-20)22-15-17-23(18-16-22)27(28,29)30/h4-13,15-18,31H,2-3,14,19H2,1H3/b26-25+ |
| InChIKey | DANVAZNJRGRMCQ-OCEACIFDSA-N |
| XLogP | 7.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|