C7H19N5S — CID 89325213
1,3-diamino-1-[2-(diethylamino)ethyl]thiourea (PubChem CID 89325213) has the molecular formula C7H19N5S and a molecular weight of 205.33 g/mol. Its IUPAC name is 1,3-diamino-1-[2-(diethylamino)ethyl]thiourea.
| Compound Name | 1,3-diamino-1-[2-(diethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 89325213 |
| Molecular Formula | C7H19N5S |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | 1,3-diamino-1-[2-(diethylamino)ethyl]thiourea |
| SMILES | CCN(CC)CCN(N)C(=S)NN |
| InChI | InChI=1S/C7H19N5S/c1-3-11(4-2)5-6-12(9)7(13)10-8/h3-6,8-9H2,1-2H3,(H,10,13) |
| InChIKey | MSROKPKABYDKFI-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 70.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|