C17H23N2OS+ — CID 8933405
cyclopentyl-[[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methyl]azanium (PubChem CID 8933405) has the molecular formula C17H23N2OS+ and a molecular weight of 303.45 g/mol. Its IUPAC name is cyclopentyl-[[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methyl]azanium.
| Compound Name | cyclopentyl-[[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methyl]azanium |
|---|---|
| PubChem CID | 8933405 |
| Molecular Formula | C17H23N2OS+ |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | cyclopentyl-[[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methyl]azanium |
| SMILES | CCOc1ccc(-c2nc(C[NH2+]C3CCCC3)cs2)cc1 |
| InChI | InChI=1S/C17H22N2OS/c1-2-20-16-9-7-13(8-10-16)17-19-15(12-21-17)11-18-14-5-3-4-6-14/h7-10,12,14,18H,2-6,11H2,1H3/p+1 |
| InChIKey | REDBPZVNYZRIPV-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 38.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |