C11H11NOS2 — CID 116889638
2-(4-ethoxyphenyl)-1,3-thiazole-4-thiol (PubChem CID 116889638) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1,3-thiazole-4-thiol.
| Compound Name | 2-(4-ethoxyphenyl)-1,3-thiazole-4-thiol |
|---|---|
| PubChem CID | 116889638 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1,3-thiazole-4-thiol |
| SMILES | CCOc1ccc(-c2nc(S)cs2)cc1 |
| InChI | InChI=1S/C11H11NOS2/c1-2-13-9-5-3-8(4-6-9)11-12-10(14)7-15-11/h3-7,14H,2H2,1H3 |
| InChIKey | SIHKCIPBIWCGGX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|