C24H31Cl2FN2O2S — CID 89334738
N-[(2S,9S)-9-amino-10-(2-fluorophenyl)-2-methyl-7-methylidenedecyl]-2,5-dichlorobenzenesulfonamide (PubChem CID 89334738) has the molecular formula C24H31Cl2FN2O2S and a molecular weight of 501.50 g/mol. Its IUPAC name is N-[(2S,9S)-9-amino-10-(2-fluorophenyl)-2-methyl-7-methylidenedecyl]-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-[(2S,9S)-9-amino-10-(2-fluorophenyl)-2-methyl-7-methylidenedecyl]-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 89334738 |
| Molecular Formula | C24H31Cl2FN2O2S |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-[(2S,9S)-9-amino-10-(2-fluorophenyl)-2-methyl-7-methylidenedecyl]-2,5-dichlorobenzenesulfonamide |
| SMILES | C=C(CCCC[C@H](C)CNS(=O)(=O)c1cc(Cl)ccc1Cl)C[C@H](N)Cc1ccccc1F |
| InChI | InChI=1S/C24H31Cl2FN2O2S/c1-17(13-21(28)14-19-9-5-6-10-23(19)27)7-3-4-8-18(2)16-29-32(30,31)24-15-20(25)11-12-22(24)26/h5-6,9-12,15,18,21,29H,1,3-4,7-8,13-14,16,28H2,2H3/t18-,21-/m0/s1 |
| InChIKey | QVGHVONWSOXSSS-RXVVDRJESA-N |
| XLogP | 6.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|