C14H39N2O13P4+ — CID 89336477
6-aminohexan-1-ol;bis(diphosphonomethyl)-dipropylazanium (PubChem CID 89336477) has the molecular formula C14H39N2O13P4+ and a molecular weight of 567.36 g/mol. Its IUPAC name is 6-aminohexan-1-ol;bis(diphosphonomethyl)-dipropylazanium.
| Compound Name | 6-aminohexan-1-ol;bis(diphosphonomethyl)-dipropylazanium |
|---|---|
| PubChem CID | 89336477 |
| Molecular Formula | C14H39N2O13P4+ |
| Molecular Weight | 567.36 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 6-aminohexan-1-ol;bis(diphosphonomethyl)-dipropylazanium |
| SMILES | CCC[N+](CCC)(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O.NCCCCCCO |
| InChI | InChI=1S/C8H23NO12P4.C6H15NO/c1-3-5-9(6-4-2,7(22(10,11)12)23(13,14)15)8(24(16,17)18)25(19,20)21;7-5-3-1-2-4-6-8/h7-8H,3-6H2,1-2H3,(H7-,10,11,12,13,14,15,16,17,18,19,20,21);8H,1-7H2/p+1 |
| InChIKey | LCSBVUGLBHSHIQ-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 276.37 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|