C11H31N2O14P4+ — CID 89336484
(2S)-2-aminopropanoic acid;bis(diphosphonomethyl)-dipropylazanium (PubChem CID 89336484) has the molecular formula C11H31N2O14P4+ and a molecular weight of 539.27 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;bis(diphosphonomethyl)-dipropylazanium.
| Compound Name | (2S)-2-aminopropanoic acid;bis(diphosphonomethyl)-dipropylazanium |
|---|---|
| PubChem CID | 89336484 |
| Molecular Formula | C11H31N2O14P4+ |
| Molecular Weight | 539.27 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | (2S)-2-aminopropanoic acid;bis(diphosphonomethyl)-dipropylazanium |
| SMILES | CCC[N+](CCC)(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H23NO12P4.C3H7NO2/c1-3-5-9(6-4-2,7(22(10,11)12)23(13,14)15)8(24(16,17)18)25(19,20)21;1-2(4)3(5)6/h7-8H,3-6H2,1-2H3,(H7-,10,11,12,13,14,15,16,17,18,19,20,21);2H,4H2,1H3,(H,5,6)/p+1/t;2-/m.0/s1 |
| InChIKey | QNKIDBAWXAQVGT-WNQIDUERSA-O |
| XLogP | -0.68 |
| TPSA | 293.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|