About aminophosphonic acid;(2R)-2-aminopropanoic acid
aminophosphonic acid;(2R)-2-aminopropanoic acid (PubChem CID 118047649) has the molecular formula C3H11N2O5P
and a molecular weight of 186.10 g/mol. Its IUPAC name is aminophosphonic acid;(2R)-2-aminopropanoic acid.
Molecular Properties
| Compound Name | aminophosphonic acid;(2R)-2-aminopropanoic acid |
| PubChem CID | 118047649 |
| Molecular Formula | C3H11N2O5P |
| Molecular Weight | 186.10 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | aminophosphonic acid;(2R)-2-aminopropanoic acid |
| SMILES | C[C@@H](N)C(=O)O.NP(=O)(O)O |
| InChI | InChI=1S/C3H7NO2.H4NO3P/c1-2(4)3(5)6;1-5(2,3)4/h2H,4H2,1H3,(H,5,6);(H4,1,2,3,4)/t2-;/m1./s1 |
| InChIKey | MINRXURAIMGPKB-HSHFZTNMSA-N |
| XLogP | -1.54 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.10 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aminophosphonic acid;(2R)-2-aminopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminophosphonic acid;(2R)-2-aminopropanoic acid?
The IUPAC name of aminophosphonic acid;(2R)-2-aminopropanoic acid (CID 118047649) is aminophosphonic acid;(2R)-2-aminopropanoic acid.
What is the SMILES notation for aminophosphonic acid;(2R)-2-aminopropanoic acid?
The canonical SMILES for aminophosphonic acid;(2R)-2-aminopropanoic acid is C[C@@H](N)C(=O)O.NP(=O)(O)O.
What is the InChIKey of aminophosphonic acid;(2R)-2-aminopropanoic acid?
The InChIKey is MINRXURAIMGPKB-HSHFZTNMSA-N. The full InChI is InChI=1S/C3H7NO2.H4NO3P/c1-2(4)3(5)6;1-5(2,3)4/h2H,4H2,1H3,(H,5,6);(H4,1,2,3,4)/t2-;/m1./s1.
What are the key properties of aminophosphonic acid;(2R)-2-aminopropanoic acid?
aminophosphonic acid;(2R)-2-aminopropanoic acid has a molecular weight of 186.10 g/mol, XLogP of -1.54, 1 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminophosphonic acid;(2R)-2-aminopropanoic acid is sourced from PubChem (CID 118047649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).