aminophosphonic acid;(2R)-2-aminopropanoic acid

C3H11N2O5P — CID 118047649

IUPACaminophosphonic acid;(2R)-2-aminopropanoic acid
SMILESC[C@@H](N)C(=O)O.NP(=O)(O)O
InChIInChI=1S/C3H7NO2.H4NO3P/c1-2(4)3(5)6;1-5(2,3)4/h2H,4H2,1H3,(H,5,6);(H4,1,2,3,4)/t2-;/m1./s1
InChIKeyMINRXURAIMGPKB-HSHFZTNMSA-N
MW186.10 g/mol
LogP-1.54
Rot. Bonds1

About aminophosphonic acid;(2R)-2-aminopropanoic acid

aminophosphonic acid;(2R)-2-aminopropanoic acid (PubChem CID 118047649) has the molecular formula C3H11N2O5P and a molecular weight of 186.10 g/mol. Its IUPAC name is aminophosphonic acid;(2R)-2-aminopropanoic acid.

Molecular Properties

Compound Nameaminophosphonic acid;(2R)-2-aminopropanoic acid
PubChem CID118047649
Molecular FormulaC3H11N2O5P
Molecular Weight186.10 g/mol
Exact Mass186.04
IUPAC Nameaminophosphonic acid;(2R)-2-aminopropanoic acid
SMILESC[C@@H](N)C(=O)O.NP(=O)(O)O
InChIInChI=1S/C3H7NO2.H4NO3P/c1-2(4)3(5)6;1-5(2,3)4/h2H,4H2,1H3,(H,5,6);(H4,1,2,3,4)/t2-;/m1./s1
InChIKeyMINRXURAIMGPKB-HSHFZTNMSA-N
XLogP-1.54
TPSA146.87 Ų
H-Bond Donors5
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.10
LogP ≤ 5-1.54
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze aminophosphonic acid;(2R)-2-aminopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of aminophosphonic acid;(2R)-2-aminopropanoic acid?
The IUPAC name of aminophosphonic acid;(2R)-2-aminopropanoic acid (CID 118047649) is aminophosphonic acid;(2R)-2-aminopropanoic acid.
What is the SMILES notation for aminophosphonic acid;(2R)-2-aminopropanoic acid?
The canonical SMILES for aminophosphonic acid;(2R)-2-aminopropanoic acid is C[C@@H](N)C(=O)O.NP(=O)(O)O.
What is the InChIKey of aminophosphonic acid;(2R)-2-aminopropanoic acid?
The InChIKey is MINRXURAIMGPKB-HSHFZTNMSA-N. The full InChI is InChI=1S/C3H7NO2.H4NO3P/c1-2(4)3(5)6;1-5(2,3)4/h2H,4H2,1H3,(H,5,6);(H4,1,2,3,4)/t2-;/m1./s1.
What are the key properties of aminophosphonic acid;(2R)-2-aminopropanoic acid?
aminophosphonic acid;(2R)-2-aminopropanoic acid has a molecular weight of 186.10 g/mol, XLogP of -1.54, 1 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminophosphonic acid;(2R)-2-aminopropanoic acid is sourced from PubChem (CID 118047649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).