C38H27N3 — CID 89336632
(1Z,3E)-3-(6-phenyl-3,8-dipyridin-4-ylpyren-1-yl)hexa-1,3,5-trien-1-amine (PubChem CID 89336632) has the molecular formula C38H27N3 and a molecular weight of 525.66 g/mol. Its IUPAC name is (1Z,3E)-3-(6-phenyl-3,8-dipyridin-4-ylpyren-1-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-(6-phenyl-3,8-dipyridin-4-ylpyren-1-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89336632 |
| Molecular Formula | C38H27N3 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (1Z,3E)-3-(6-phenyl-3,8-dipyridin-4-ylpyren-1-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)c1cc(-c2ccncc2)c2ccc3c(-c4ccccc4)cc(-c4ccncc4)c4ccc1c2c43 |
| InChI | InChI=1S/C38H27N3/c1-2-6-25(13-18-39)33-23-35(27-14-19-40-20-15-27)31-12-10-30-34(26-7-4-3-5-8-26)24-36(28-16-21-41-22-17-28)32-11-9-29(33)37(31)38(30)32/h2-24H,1,39H2/b18-13-,25-6+ |
| InChIKey | PJQKCXAQIPHQQT-RPGDSQPXSA-N |
| XLogP | 9.42 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|