C8H6F6N2 — CID 89338191
2-[1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-yl]-1H-imidazole (PubChem CID 89338191) has the molecular formula C8H6F6N2 and a molecular weight of 244.14 g/mol. Its IUPAC name is 2-[1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-yl]-1H-imidazole.
| Compound Name | 2-[1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 89338191 |
| Molecular Formula | C8H6F6N2 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-[1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-yl]-1H-imidazole |
| SMILES | C=CC(c1ncc[nH]1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F6N2/c1-2-6(7(9,10)11,8(12,13)14)5-15-3-4-16-5/h2-4H,1H2,(H,15,16) |
| InChIKey | JHSIWWKTSJPDDX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|