C18H18F3IN2O — CID 89339998
(7R,8S)-8-(2-iodopropyl)-6-(trifluoromethyl)-3,7,8,9,9a,10-hexahydroindeno[2,1-e]indazol-7-ol (PubChem CID 89339998) has the molecular formula C18H18F3IN2O and a molecular weight of 462.25 g/mol. Its IUPAC name is (7R,8S)-8-(2-iodopropyl)-6-(trifluoromethyl)-3,7,8,9,9a,10-hexahydroindeno[2,1-e]indazol-7-ol.
| Compound Name | (7R,8S)-8-(2-iodopropyl)-6-(trifluoromethyl)-3,7,8,9,9a,10-hexahydroindeno[2,1-e]indazol-7-ol |
|---|---|
| PubChem CID | 89339998 |
| Molecular Formula | C18H18F3IN2O |
| Molecular Weight | 462.25 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | (7R,8S)-8-(2-iodopropyl)-6-(trifluoromethyl)-3,7,8,9,9a,10-hexahydroindeno[2,1-e]indazol-7-ol |
| SMILES | CC(I)C[C@@H]1CC2Cc3c(ccc4[nH]ncc34)C2=C(C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C18H18F3IN2O/c1-8(22)4-10-5-9-6-12-11(2-3-14-13(12)7-23-24-14)15(9)16(17(10)25)18(19,20)21/h2-3,7-10,17,25H,4-6H2,1H3,(H,23,24)/t8?,9?,10-,17-/m1/s1 |
| InChIKey | PWGDAHJECGYYSK-XVYNBGFYSA-N |
| XLogP | 4.65 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|