C15H12F4N2 — CID 143519590
(10R)-10-fluoro-6-(trifluoromethyl)-3,7,8,9,9a,10-hexahydroindeno[2,1-e]indazole (PubChem CID 143519590) has the molecular formula C15H12F4N2 and a molecular weight of 296.27 g/mol. Its IUPAC name is (10R)-10-fluoro-6-(trifluoromethyl)-3,7,8,9,9a,10-hexahydroindeno[2,1-e]indazole.
| Compound Name | (10R)-10-fluoro-6-(trifluoromethyl)-3,7,8,9,9a,10-hexahydroindeno[2,1-e]indazole |
|---|---|
| PubChem CID | 143519590 |
| Molecular Formula | C15H12F4N2 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (10R)-10-fluoro-6-(trifluoromethyl)-3,7,8,9,9a,10-hexahydroindeno[2,1-e]indazole |
| SMILES | F[C@H]1c2c(ccc3[nH]ncc23)C2=C(C(F)(F)F)CCCC21 |
| InChI | InChI=1S/C15H12F4N2/c16-14-8-2-1-3-10(15(17,18)19)12(8)7-4-5-11-9(13(7)14)6-20-21-11/h4-6,8,14H,1-3H2,(H,20,21)/t8?,14-/m1/s1 |
| InChIKey | JTQVZVOAKSSHFH-NVDIHYKVSA-N |
| XLogP | 4.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |