C46H43N — CID 89341996
7,12-ditert-butyl-9-(9,9-dimethyl-7-phenylfluoren-2-yl)naphtho[2,3-h]quinoline (PubChem CID 89341996) has the molecular formula C46H43N and a molecular weight of 609.86 g/mol. Its IUPAC name is 7,12-ditert-butyl-9-(9,9-dimethyl-7-phenylfluoren-2-yl)naphtho[2,3-h]quinoline.
| Compound Name | 7,12-ditert-butyl-9-(9,9-dimethyl-7-phenylfluoren-2-yl)naphtho[2,3-h]quinoline |
|---|---|
| PubChem CID | 89341996 |
| Molecular Formula | C46H43N |
| Molecular Weight | 609.86 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | 7,12-ditert-butyl-9-(9,9-dimethyl-7-phenylfluoren-2-yl)naphtho[2,3-h]quinoline |
| SMILES | CC(C)(C)c1c2cc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccccc5)ccc3-4)ccc2c(C(C)(C)C)c2c1ccc1cccnc12 |
| InChI | InChI=1S/C46H43N/c1-44(2,3)41-36-23-16-29-15-12-24-47-43(29)40(36)42(45(4,5)6)35-22-19-30(25-37(35)41)32-18-21-34-33-20-17-31(28-13-10-9-11-14-28)26-38(33)46(7,8)39(34)27-32/h9-27H,1-8H3 |
| InChIKey | DZVYWGGHJFQABT-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.86 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|