C28H29N5O2 — CID 89343177
6-imidazol-1-yl-2-[2-[N-methyl-3-[methyl(propyl)amino]anilino]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 89343177) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 6-imidazol-1-yl-2-[2-[N-methyl-3-[methyl(propyl)amino]anilino]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-imidazol-1-yl-2-[2-[N-methyl-3-[methyl(propyl)amino]anilino]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 89343177 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 6-imidazol-1-yl-2-[2-[N-methyl-3-[methyl(propyl)amino]anilino]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCN(C)c1cccc(N(C)CCN2C(=O)c3cccc4c(-n5ccnc5)ccc(c34)C2=O)c1 |
| InChI | InChI=1S/C28H29N5O2/c1-4-14-30(2)20-7-5-8-21(18-20)31(3)16-17-33-27(34)23-10-6-9-22-25(32-15-13-29-19-32)12-11-24(26(22)23)28(33)35/h5-13,15,18-19H,4,14,16-17H2,1-3H3 |
| InChIKey | JAQPRXFKSMUXHU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|