C22H19F6N3O2 — CID 89343817
4-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propylamino]-2-(trifluoromethyl)benzonitrile (PubChem CID 89343817) has the molecular formula C22H19F6N3O2 and a molecular weight of 471.40 g/mol. Its IUPAC name is 4-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propylamino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propylamino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 89343817 |
| Molecular Formula | C22H19F6N3O2 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 4-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propylamino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCCc1c(OCCCNc2ccc(C#N)c(C(F)(F)F)c2)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C22H19F6N3O2/c1-2-4-15-18(8-7-16-19(15)33-31-20(16)22(26,27)28)32-10-3-9-30-14-6-5-13(12-29)17(11-14)21(23,24)25/h5-8,11,30H,2-4,9-10H2,1H3 |
| InChIKey | QKUHURVQGMIBHB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|