C18H21N5O4 — CID 89344272
1-[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-2-(1-methylpyrazol-4-yl)-3-oxopropan-2-yl]-3-methylurea (PubChem CID 89344272) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-2-(1-methylpyrazol-4-yl)-3-oxopropan-2-yl]-3-methylurea.
| Compound Name | 1-[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-2-(1-methylpyrazol-4-yl)-3-oxopropan-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 89344272 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-2-(1-methylpyrazol-4-yl)-3-oxopropan-2-yl]-3-methylurea |
| SMILES | CNC(=O)N[C@@](C=O)(CN1Cc2ccc(OC)cc2C1=O)c1cnn(C)c1 |
| InChI | InChI=1S/C18H21N5O4/c1-19-17(26)21-18(11-24,13-7-20-22(2)9-13)10-23-8-12-4-5-14(27-3)6-15(12)16(23)25/h4-7,9,11H,8,10H2,1-3H3,(H2,19,21,26)/t18-/m1/s1 |
| InChIKey | SRLSJWJPIFQYLM-GOSISDBHSA-N |
| XLogP | 0.41 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|