C21H22N4O5 — CID 89070279
3-[(2R)-2-(carbamoylamino)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-3-oxopropan-2-yl]-4-methylbenzamide (PubChem CID 89070279) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 3-[(2R)-2-(carbamoylamino)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-3-oxopropan-2-yl]-4-methylbenzamide.
| Compound Name | 3-[(2R)-2-(carbamoylamino)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-3-oxopropan-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 89070279 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-[(2R)-2-(carbamoylamino)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-3-oxopropan-2-yl]-4-methylbenzamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@](C=O)(NC(N)=O)c1cc(C(N)=O)ccc1C)C2 |
| InChI | InChI=1S/C21H22N4O5/c1-12-3-4-13(18(22)27)7-17(12)21(11-26,24-20(23)29)10-25-9-14-5-6-15(30-2)8-16(14)19(25)28/h3-8,11H,9-10H2,1-2H3,(H2,22,27)(H3,23,24,29)/t21-/m1/s1 |
| InChIKey | SBDGSVYEDSKKHP-OAQYLSRUSA-N |
| XLogP | 0.82 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|