C15H15N3O4 — CID 118927873
(2S)-N-carbamoyl-2-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]but-3-ynamide (PubChem CID 118927873) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]but-3-ynamide.
| Compound Name | (2S)-N-carbamoyl-2-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]but-3-ynamide |
|---|---|
| PubChem CID | 118927873 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (2S)-N-carbamoyl-2-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]but-3-ynamide |
| SMILES | C#C[C@@H](CN1Cc2ccc(OC)cc2C1=O)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H15N3O4/c1-3-9(13(19)17-15(16)21)7-18-8-10-4-5-11(22-2)6-12(10)14(18)20/h1,4-6,9H,7-8H2,2H3,(H3,16,17,19,21)/t9-/m0/s1 |
| InChIKey | OUFMIQJZNNAPNJ-VIFPVBQESA-N |
| XLogP | 0.10 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|