C21H21F2N3O4 — CID 88973971
N-[[(2R)-4-(3,5-difluorophenyl)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)butan-2-yl]carbamoyl]formamide (PubChem CID 88973971) has the molecular formula C21H21F2N3O4 and a molecular weight of 417.41 g/mol. Its IUPAC name is N-[[(2R)-4-(3,5-difluorophenyl)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)butan-2-yl]carbamoyl]formamide.
| Compound Name | N-[[(2R)-4-(3,5-difluorophenyl)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)butan-2-yl]carbamoyl]formamide |
|---|---|
| PubChem CID | 88973971 |
| Molecular Formula | C21H21F2N3O4 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[[(2R)-4-(3,5-difluorophenyl)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)butan-2-yl]carbamoyl]formamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@H](CCc1cc(F)cc(F)c1)NC(=O)NC=O)C2 |
| InChI | InChI=1S/C21H21F2N3O4/c1-30-18-5-3-14-10-26(20(28)19(14)9-18)11-17(25-21(29)24-12-27)4-2-13-6-15(22)8-16(23)7-13/h3,5-9,12,17H,2,4,10-11H2,1H3,(H2,24,25,27,29)/t17-/m1/s1 |
| InChIKey | QBSZZKJGUCEGAA-QGZVFWFLSA-N |
| XLogP | 2.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|