C24H25N5O4 — CID 89039812
N-[[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-4-(5-pyrrolidin-1-yl-3-pyridinyl)but-3-yn-2-yl]carbamoyl]formamide (PubChem CID 89039812) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-4-(5-pyrrolidin-1-yl-3-pyridinyl)but-3-yn-2-yl]carbamoyl]formamide.
| Compound Name | N-[[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-4-(5-pyrrolidin-1-yl-3-pyridinyl)but-3-yn-2-yl]carbamoyl]formamide |
|---|---|
| PubChem CID | 89039812 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-4-(5-pyrrolidin-1-yl-3-pyridinyl)but-3-yn-2-yl]carbamoyl]formamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@H](C#Cc1cncc(N3CCCC3)c1)NC(=O)NC=O)C2 |
| InChI | InChI=1S/C24H25N5O4/c1-33-21-7-5-18-14-29(23(31)22(18)11-21)15-19(27-24(32)26-16-30)6-4-17-10-20(13-25-12-17)28-8-2-3-9-28/h5,7,10-13,16,19H,2-3,8-9,14-15H2,1H3,(H2,26,27,30,32)/t19-/m1/s1 |
| InChIKey | KIAXRVCJSFQYRM-LJQANCHMSA-N |
| XLogP | 1.52 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|