C26H28ClN5O5 — CID 89039881
2-chloro-N-[2-(dimethylamino)ethyl]-5-[(3R)-3-(formylcarbamoylamino)-4-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-1-ynyl]benzamide (PubChem CID 89039881) has the molecular formula C26H28ClN5O5 and a molecular weight of 525.99 g/mol. Its IUPAC name is 2-chloro-N-[2-(dimethylamino)ethyl]-5-[(3R)-3-(formylcarbamoylamino)-4-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-1-ynyl]benzamide.
| Compound Name | 2-chloro-N-[2-(dimethylamino)ethyl]-5-[(3R)-3-(formylcarbamoylamino)-4-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-1-ynyl]benzamide |
|---|---|
| PubChem CID | 89039881 |
| Molecular Formula | C26H28ClN5O5 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-chloro-N-[2-(dimethylamino)ethyl]-5-[(3R)-3-(formylcarbamoylamino)-4-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-1-ynyl]benzamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@H](C#Cc1ccc(Cl)c(C(=O)NCCN(C)C)c1)NC(=O)NC=O)C2 |
| InChI | InChI=1S/C26H28ClN5O5/c1-31(2)11-10-28-24(34)22-12-17(5-9-23(22)27)4-7-19(30-26(36)29-16-33)15-32-14-18-6-8-20(37-3)13-21(18)25(32)35/h5-6,8-9,12-13,16,19H,10-11,14-15H2,1-3H3,(H,28,34)(H2,29,30,33,36)/t19-/m1/s1 |
| InChIKey | ZSYGRYDIEMMTPK-LJQANCHMSA-N |
| XLogP | 1.47 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|