C22H19N7O5 — CID 89039771
N-[[(2R)-4-[6-(5-amino-1,3,4-oxadiazol-2-yl)-3-pyridinyl]-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-3-yn-2-yl]carbamoyl]formamide (PubChem CID 89039771) has the molecular formula C22H19N7O5 and a molecular weight of 461.44 g/mol. Its IUPAC name is N-[[(2R)-4-[6-(5-amino-1,3,4-oxadiazol-2-yl)-3-pyridinyl]-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-3-yn-2-yl]carbamoyl]formamide.
| Compound Name | N-[[(2R)-4-[6-(5-amino-1,3,4-oxadiazol-2-yl)-3-pyridinyl]-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-3-yn-2-yl]carbamoyl]formamide |
|---|---|
| PubChem CID | 89039771 |
| Molecular Formula | C22H19N7O5 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[[(2R)-4-[6-(5-amino-1,3,4-oxadiazol-2-yl)-3-pyridinyl]-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-3-yn-2-yl]carbamoyl]formamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@H](C#Cc1ccc(-c3nnc(N)o3)nc1)NC(=O)NC=O)C2 |
| InChI | InChI=1S/C22H19N7O5/c1-33-16-6-4-14-10-29(20(31)17(14)8-16)11-15(26-22(32)25-12-30)5-2-13-3-7-18(24-9-13)19-27-28-21(23)34-19/h3-4,6-9,12,15H,10-11H2,1H3,(H2,23,28)(H2,25,26,30,32)/t15-/m1/s1 |
| InChIKey | QZUWYHXGKMFCKE-OAHLLOKOSA-N |
| XLogP | 0.55 |
| TPSA | 165.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|