C23H24N4O5 — CID 88570087
1-[4-[(1R)-1-(formylcarbamoylamino)-2-(5-methoxy-3-oxo-1H-isoindol-2-yl)ethyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 88570087) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 1-[4-[(1R)-1-(formylcarbamoylamino)-2-(5-methoxy-3-oxo-1H-isoindol-2-yl)ethyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[4-[(1R)-1-(formylcarbamoylamino)-2-(5-methoxy-3-oxo-1H-isoindol-2-yl)ethyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 88570087 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1-[4-[(1R)-1-(formylcarbamoylamino)-2-(5-methoxy-3-oxo-1H-isoindol-2-yl)ethyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@H](NC(=O)NC=O)c1ccc(C3(C(N)=O)CC3)cc1)C2 |
| InChI | InChI=1S/C23H24N4O5/c1-32-17-7-4-15-11-27(20(29)18(15)10-17)12-19(26-22(31)25-13-28)14-2-5-16(6-3-14)23(8-9-23)21(24)30/h2-7,10,13,19H,8-9,11-12H2,1H3,(H2,24,30)(H2,25,26,28,31)/t19-/m0/s1 |
| InChIKey | GJDZGPRUTHSPSZ-IBGZPJMESA-N |
| XLogP | 1.36 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|