C22H19F2N3O5 — CID 89180289
N-[[(2R)-4-(4,5-difluoro-2-methoxyphenyl)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-3-yn-2-yl]carbamoyl]formamide (PubChem CID 89180289) has the molecular formula C22H19F2N3O5 and a molecular weight of 443.41 g/mol. Its IUPAC name is N-[[(2R)-4-(4,5-difluoro-2-methoxyphenyl)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-3-yn-2-yl]carbamoyl]formamide.
| Compound Name | N-[[(2R)-4-(4,5-difluoro-2-methoxyphenyl)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-3-yn-2-yl]carbamoyl]formamide |
|---|---|
| PubChem CID | 89180289 |
| Molecular Formula | C22H19F2N3O5 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[[(2R)-4-(4,5-difluoro-2-methoxyphenyl)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)but-3-yn-2-yl]carbamoyl]formamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@H](C#Cc1cc(F)c(F)cc1OC)NC(=O)NC=O)C2 |
| InChI | InChI=1S/C22H19F2N3O5/c1-31-16-6-4-14-10-27(21(29)17(14)8-16)11-15(26-22(30)25-12-28)5-3-13-7-18(23)19(24)9-20(13)32-2/h4,6-9,12,15H,10-11H2,1-2H3,(H2,25,26,28,30)/t15-/m1/s1 |
| InChIKey | UCLCWJJVGDURJN-OAHLLOKOSA-N |
| XLogP | 1.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|