C26H29N7O4 — CID 88570046
N-[[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-4-[6-(4-methylpiperazine-1-carboximidoyl)-3-pyridinyl]but-3-yn-2-yl]carbamoyl]formamide (PubChem CID 88570046) has the molecular formula C26H29N7O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is N-[[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-4-[6-(4-methylpiperazine-1-carboximidoyl)-3-pyridinyl]but-3-yn-2-yl]carbamoyl]formamide.
| Compound Name | N-[[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-4-[6-(4-methylpiperazine-1-carboximidoyl)-3-pyridinyl]but-3-yn-2-yl]carbamoyl]formamide |
|---|---|
| PubChem CID | 88570046 |
| Molecular Formula | C26H29N7O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N-[[(2R)-1-(5-methoxy-3-oxo-1H-isoindol-2-yl)-4-[6-(4-methylpiperazine-1-carboximidoyl)-3-pyridinyl]but-3-yn-2-yl]carbamoyl]formamide |
| SMILES | [H]/N=C(/c1ccc(C#C[C@H](CN2Cc3ccc(OC)cc3C2=O)NC(=O)NC=O)cn1)N1CCN(C)CC1 |
| InChI | InChI=1S/C26H29N7O4/c1-31-9-11-32(12-10-31)24(27)23-8-4-18(14-28-23)3-6-20(30-26(36)29-17-34)16-33-15-19-5-7-21(37-2)13-22(19)25(33)35/h4-5,7-8,13-14,17,20,27H,9-12,15-16H2,1-2H3,(H2,29,30,34,36)/b27-24-/t20-/m1/s1 |
| InChIKey | FWUKFTVRXAPSDP-XFMXRJAISA-N |
| XLogP | 0.49 |
| TPSA | 130.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|