C26H28N4O4 — CID 89205822
[2-[1-(2-ethynylphenyl)piperidin-4-yl]-1-(6-methoxy-3-oxo-1H-isoindol-2-yl)-3-oxopropan-2-yl]urea (PubChem CID 89205822) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is [2-[1-(2-ethynylphenyl)piperidin-4-yl]-1-(6-methoxy-3-oxo-1H-isoindol-2-yl)-3-oxopropan-2-yl]urea.
| Compound Name | [2-[1-(2-ethynylphenyl)piperidin-4-yl]-1-(6-methoxy-3-oxo-1H-isoindol-2-yl)-3-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 89205822 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [2-[1-(2-ethynylphenyl)piperidin-4-yl]-1-(6-methoxy-3-oxo-1H-isoindol-2-yl)-3-oxopropan-2-yl]urea |
| SMILES | C#Cc1ccccc1N1CCC(C(C=O)(CN2Cc3cc(OC)ccc3C2=O)NC(N)=O)CC1 |
| InChI | InChI=1S/C26H28N4O4/c1-3-18-6-4-5-7-23(18)29-12-10-20(11-13-29)26(17-31,28-25(27)33)16-30-15-19-14-21(34-2)8-9-22(19)24(30)32/h1,4-9,14,17,20H,10-13,15-16H2,2H3,(H3,27,28,33) |
| InChIKey | KCVSBWMSGBHBQH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|