C24H21F2NOS — CID 89344345
(2Z,4Z)-3-(2,4-difluorophenyl)-1-pyridin-3-yl-2-[(E)-1-thiophen-2-ylprop-1-enyl]hexa-2,4-dien-1-ol (PubChem CID 89344345) has the molecular formula C24H21F2NOS and a molecular weight of 409.50 g/mol. Its IUPAC name is (2Z,4Z)-3-(2,4-difluorophenyl)-1-pyridin-3-yl-2-[(E)-1-thiophen-2-ylprop-1-enyl]hexa-2,4-dien-1-ol.
| Compound Name | (2Z,4Z)-3-(2,4-difluorophenyl)-1-pyridin-3-yl-2-[(E)-1-thiophen-2-ylprop-1-enyl]hexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 89344345 |
| Molecular Formula | C24H21F2NOS |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (2Z,4Z)-3-(2,4-difluorophenyl)-1-pyridin-3-yl-2-[(E)-1-thiophen-2-ylprop-1-enyl]hexa-2,4-dien-1-ol |
| SMILES | C/C=C\C(=C(C(=C\C)/c1cccs1)\C(O)c1cccnc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H21F2NOS/c1-3-7-20(19-11-10-17(25)14-21(19)26)23(18(4-2)22-9-6-13-29-22)24(28)16-8-5-12-27-15-16/h3-15,24,28H,1-2H3/b7-3-,18-4-,23-20- |
| InChIKey | YAJMKLJWYKRHJK-AGWBBCKZSA-N |
| XLogP | 6.59 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|