C27H26ClF2NO — CID 91519784
2-[1-(4-chloro-2-fluorophenyl)prop-1-enyl]-3-(3-fluorophenyl)-4-methyl-1-pyridin-3-ylhex-2-en-1-ol (PubChem CID 91519784) has the molecular formula C27H26ClF2NO and a molecular weight of 453.96 g/mol. Its IUPAC name is 2-[1-(4-chloro-2-fluorophenyl)prop-1-enyl]-3-(3-fluorophenyl)-4-methyl-1-pyridin-3-ylhex-2-en-1-ol.
| Compound Name | 2-[1-(4-chloro-2-fluorophenyl)prop-1-enyl]-3-(3-fluorophenyl)-4-methyl-1-pyridin-3-ylhex-2-en-1-ol |
|---|---|
| PubChem CID | 91519784 |
| Molecular Formula | C27H26ClF2NO |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[1-(4-chloro-2-fluorophenyl)prop-1-enyl]-3-(3-fluorophenyl)-4-methyl-1-pyridin-3-ylhex-2-en-1-ol |
| SMILES | CC=C(C(=C(c1cccc(F)c1)C(C)CC)C(O)c1cccnc1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C27H26ClF2NO/c1-4-17(3)25(18-8-6-10-21(29)14-18)26(27(32)19-9-7-13-31-16-19)22(5-2)23-12-11-20(28)15-24(23)30/h5-17,27,32H,4H2,1-3H3 |
| InChIKey | LFULCCKZDOKLSO-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|