C21H17Cl2NO2 — CID 143201409
(E)-1-(4-chlorophenyl)-2-[(3-chlorophenyl)methyl]-3-pyridin-3-ylprop-1-ene-1,3-diol (PubChem CID 143201409) has the molecular formula C21H17Cl2NO2 and a molecular weight of 386.28 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-2-[(3-chlorophenyl)methyl]-3-pyridin-3-ylprop-1-ene-1,3-diol.
| Compound Name | (E)-1-(4-chlorophenyl)-2-[(3-chlorophenyl)methyl]-3-pyridin-3-ylprop-1-ene-1,3-diol |
|---|---|
| PubChem CID | 143201409 |
| Molecular Formula | C21H17Cl2NO2 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-2-[(3-chlorophenyl)methyl]-3-pyridin-3-ylprop-1-ene-1,3-diol |
| SMILES | O/C(=C(\Cc1cccc(Cl)c1)C(O)c1cccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17Cl2NO2/c22-17-8-6-15(7-9-17)20(25)19(12-14-3-1-5-18(23)11-14)21(26)16-4-2-10-24-13-16/h1-11,13,21,25-26H,12H2/b20-19+ |
| InChIKey | LMIPDABAOTZALW-FMQUCBEESA-N |
| XLogP | 5.63 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|