C25H25ClN2O2 — CID 153035256
3-amino-1-(4-butylphenyl)-3-(4-chlorophenyl)-2-[hydroxy(pyridin-3-yl)methyl]prop-2-en-1-one (PubChem CID 153035256) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 3-amino-1-(4-butylphenyl)-3-(4-chlorophenyl)-2-[hydroxy(pyridin-3-yl)methyl]prop-2-en-1-one.
| Compound Name | 3-amino-1-(4-butylphenyl)-3-(4-chlorophenyl)-2-[hydroxy(pyridin-3-yl)methyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 153035256 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-amino-1-(4-butylphenyl)-3-(4-chlorophenyl)-2-[hydroxy(pyridin-3-yl)methyl]prop-2-en-1-one |
| SMILES | CCCCc1ccc(C(=O)C(=C(N)c2ccc(Cl)cc2)C(O)c2cccnc2)cc1 |
| InChI | InChI=1S/C25H25ClN2O2/c1-2-3-5-17-7-9-19(10-8-17)24(29)22(25(30)20-6-4-15-28-16-20)23(27)18-11-13-21(26)14-12-18/h4,6-16,25,30H,2-3,5,27H2,1H3 |
| InChIKey | BLTGAHYFRDJACJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|