C23H21Cl2NO2S — CID 91329622
(E)-1-(3-chlorophenyl)-3-(5-chlorothiophen-3-yl)-2-[hydroxy(pyridin-3-yl)methyl]-4-methylhex-2-en-1-one (PubChem CID 91329622) has the molecular formula C23H21Cl2NO2S and a molecular weight of 446.40 g/mol. Its IUPAC name is (E)-1-(3-chlorophenyl)-3-(5-chlorothiophen-3-yl)-2-[hydroxy(pyridin-3-yl)methyl]-4-methylhex-2-en-1-one.
| Compound Name | (E)-1-(3-chlorophenyl)-3-(5-chlorothiophen-3-yl)-2-[hydroxy(pyridin-3-yl)methyl]-4-methylhex-2-en-1-one |
|---|---|
| PubChem CID | 91329622 |
| Molecular Formula | C23H21Cl2NO2S |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | (E)-1-(3-chlorophenyl)-3-(5-chlorothiophen-3-yl)-2-[hydroxy(pyridin-3-yl)methyl]-4-methylhex-2-en-1-one |
| SMILES | CCC(C)/C(=C(\C(=O)c1cccc(Cl)c1)C(O)c1cccnc1)c1csc(Cl)c1 |
| InChI | InChI=1S/C23H21Cl2NO2S/c1-3-14(2)20(17-11-19(25)29-13-17)21(23(28)16-7-5-9-26-12-16)22(27)15-6-4-8-18(24)10-15/h4-14,23,28H,3H2,1-2H3/b21-20- |
| InChIKey | BMODJYJDAPIKHE-MRCUWXFGSA-N |
| XLogP | 6.87 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|