C13H14ClN3 — CID 69494557
1-(3-chlorophenyl)-N'-pyridin-3-ylethane-1,2-diamine (PubChem CID 69494557) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N'-pyridin-3-ylethane-1,2-diamine.
| Compound Name | 1-(3-chlorophenyl)-N'-pyridin-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 69494557 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1-(3-chlorophenyl)-N'-pyridin-3-ylethane-1,2-diamine |
| SMILES | NC(CNc1cccnc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14ClN3/c14-11-4-1-3-10(7-11)13(15)9-17-12-5-2-6-16-8-12/h1-8,13,17H,9,15H2 |
| InChIKey | RDVXJHPDWLQPFS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |