C19H21Cl2NO — CID 54420935
2-[2-(2,4-dichlorophenyl)ethylidene]-1-pyridin-3-ylhexan-1-ol (PubChem CID 54420935) has the molecular formula C19H21Cl2NO and a molecular weight of 350.29 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethylidene]-1-pyridin-3-ylhexan-1-ol.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethylidene]-1-pyridin-3-ylhexan-1-ol |
|---|---|
| PubChem CID | 54420935 |
| Molecular Formula | C19H21Cl2NO |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethylidene]-1-pyridin-3-ylhexan-1-ol |
| SMILES | CCCCC(=CCc1ccc(Cl)cc1Cl)C(O)c1cccnc1 |
| InChI | InChI=1S/C19H21Cl2NO/c1-2-3-5-15(19(23)16-6-4-11-22-13-16)8-7-14-9-10-17(20)12-18(14)21/h4,6,8-13,19,23H,2-3,5,7H2,1H3 |
| InChIKey | WASXJTZGDXBUFD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|