About 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one
3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one (PubChem CID 160824374) has the molecular formula C14H12BrCl2NO
and a molecular weight of 361.07 g/mol. Its IUPAC name is 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one.
Molecular Properties
| Compound Name | 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one |
| PubChem CID | 160824374 |
| Molecular Formula | C14H12BrCl2NO |
| Molecular Weight | 361.07 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one |
| SMILES | Brc1cccnc1.CC(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O.C5H4BrN/c1-6(12)4-7-2-3-8(10)5-9(7)11;6-5-2-1-3-7-4-5/h2-3,5H,4H2,1H3;1-4H |
| InChIKey | SFYUEDWYCRTOPM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.07 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one?
The IUPAC name of 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one (CID 160824374) is 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one.
What is the SMILES notation for 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one?
The canonical SMILES for 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one is Brc1cccnc1.CC(=O)Cc1ccc(Cl)cc1Cl.
What is the InChIKey of 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one?
The InChIKey is SFYUEDWYCRTOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2O.C5H4BrN/c1-6(12)4-7-2-3-8(10)5-9(7)11;6-5-2-1-3-7-4-5/h2-3,5H,4H2,1H3;1-4H.
What are the key properties of 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one?
3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one has a molecular weight of 361.07 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyridine;1-(2,4-dichlorophenyl)propan-2-one is sourced from PubChem (CID 160824374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).