C13H11ClF3N3S — CID 89344356
[5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methanimine (PubChem CID 89344356) has the molecular formula C13H11ClF3N3S and a molecular weight of 333.77 g/mol. Its IUPAC name is [5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methanimine.
| Compound Name | [5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methanimine |
|---|---|
| PubChem CID | 89344356 |
| Molecular Formula | C13H11ClF3N3S |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | [5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methanimine |
| SMILES | [H]/N=C/c1c(C(F)(F)F)nn(C)c1SCc1ccccc1Cl |
| InChI | InChI=1S/C13H11ClF3N3S/c1-20-12(9(6-18)11(19-20)13(15,16)17)21-7-8-4-2-3-5-10(8)14/h2-6,18H,7H2,1H3/b18-6+ |
| InChIKey | FYYURTQUPIPZPN-NGYBGAFCSA-N |
| XLogP | 4.38 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|