C16H15ClN4O5S — CID 89346586
7-(2-chloro-4-methylanilino)-6-ethoxycarbonylpyrazolo[1,5-a]pyrimidine-3-sulfonic acid (PubChem CID 89346586) has the molecular formula C16H15ClN4O5S and a molecular weight of 410.84 g/mol. Its IUPAC name is 7-(2-chloro-4-methylanilino)-6-ethoxycarbonylpyrazolo[1,5-a]pyrimidine-3-sulfonic acid.
| Compound Name | 7-(2-chloro-4-methylanilino)-6-ethoxycarbonylpyrazolo[1,5-a]pyrimidine-3-sulfonic acid |
|---|---|
| PubChem CID | 89346586 |
| Molecular Formula | C16H15ClN4O5S |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 7-(2-chloro-4-methylanilino)-6-ethoxycarbonylpyrazolo[1,5-a]pyrimidine-3-sulfonic acid |
| SMILES | CCOC(=O)c1cnc2c(S(=O)(=O)O)cnn2c1Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C16H15ClN4O5S/c1-3-26-16(22)10-7-18-15-13(27(23,24)25)8-19-21(15)14(10)20-12-5-4-9(2)6-11(12)17/h4-8,20H,3H2,1-2H3,(H,23,24,25) |
| InChIKey | ZLTZCUSHVKJDLR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|