C14H16IN3O2 — CID 89346839
N-[[4-ethyl-3-[3-(iodomethyl)phenoxy]-1H-pyrazol-5-yl]methyl]formamide (PubChem CID 89346839) has the molecular formula C14H16IN3O2 and a molecular weight of 385.21 g/mol. Its IUPAC name is N-[[4-ethyl-3-[3-(iodomethyl)phenoxy]-1H-pyrazol-5-yl]methyl]formamide.
| Compound Name | N-[[4-ethyl-3-[3-(iodomethyl)phenoxy]-1H-pyrazol-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 89346839 |
| Molecular Formula | C14H16IN3O2 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-[[4-ethyl-3-[3-(iodomethyl)phenoxy]-1H-pyrazol-5-yl]methyl]formamide |
| SMILES | CCc1c(Oc2cccc(CI)c2)n[nH]c1CNC=O |
| InChI | InChI=1S/C14H16IN3O2/c1-2-12-13(8-16-9-19)17-18-14(12)20-11-5-3-4-10(6-11)7-15/h3-6,9H,2,7-8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | PVPNIFLTWMRBSA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|