C14H17IN4O2 — CID 89346794
[4-ethyl-3-[3-(iodomethyl)phenoxy]-1H-pyrazol-5-yl]methylurea (PubChem CID 89346794) has the molecular formula C14H17IN4O2 and a molecular weight of 400.22 g/mol. Its IUPAC name is [4-ethyl-3-[3-(iodomethyl)phenoxy]-1H-pyrazol-5-yl]methylurea.
| Compound Name | [4-ethyl-3-[3-(iodomethyl)phenoxy]-1H-pyrazol-5-yl]methylurea |
|---|---|
| PubChem CID | 89346794 |
| Molecular Formula | C14H17IN4O2 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [4-ethyl-3-[3-(iodomethyl)phenoxy]-1H-pyrazol-5-yl]methylurea |
| SMILES | CCc1c(Oc2cccc(CI)c2)n[nH]c1CNC(N)=O |
| InChI | InChI=1S/C14H17IN4O2/c1-2-11-12(8-17-14(16)20)18-19-13(11)21-10-5-3-4-9(6-10)7-15/h3-6H,2,7-8H2,1H3,(H,18,19)(H3,16,17,20) |
| InChIKey | FRXDLYNSJOCIEP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|