C16H21ClN4O2 — CID 58907110
[5-(3-chlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methylurea (PubChem CID 58907110) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is [5-(3-chlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methylurea.
| Compound Name | [5-(3-chlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methylurea |
|---|---|
| PubChem CID | 58907110 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [5-(3-chlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methylurea |
| SMILES | CCc1c(CNC(N)=O)nn(C(C)C)c1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN4O2/c1-4-13-14(9-19-16(18)22)20-21(10(2)3)15(13)23-12-7-5-6-11(17)8-12/h5-8,10H,4,9H2,1-3H3,(H3,18,19,22) |
| InChIKey | SVHVXDWCEIKIAT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |