About trichloromethyl 2,2,2-triiodoethyl carbonate
trichloromethyl 2,2,2-triiodoethyl carbonate (PubChem CID 89347248) has the molecular formula C4H2Cl3I3O3
and a molecular weight of 585.13 g/mol. Its IUPAC name is trichloromethyl 2,2,2-triiodoethyl carbonate.
Molecular Properties
| Compound Name | trichloromethyl 2,2,2-triiodoethyl carbonate |
| PubChem CID | 89347248 |
| Molecular Formula | C4H2Cl3I3O3 |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 583.62 |
| IUPAC Name | trichloromethyl 2,2,2-triiodoethyl carbonate |
| SMILES | O=C(OCC(I)(I)I)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H2Cl3I3O3/c5-4(6,7)13-2(11)12-1-3(8,9)10/h1H2 |
| InChIKey | YOHBENXIHAFWHA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze trichloromethyl 2,2,2-triiodoethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloromethyl 2,2,2-triiodoethyl carbonate?
The IUPAC name of trichloromethyl 2,2,2-triiodoethyl carbonate (CID 89347248) is trichloromethyl 2,2,2-triiodoethyl carbonate.
What is the SMILES notation for trichloromethyl 2,2,2-triiodoethyl carbonate?
The canonical SMILES for trichloromethyl 2,2,2-triiodoethyl carbonate is O=C(OCC(I)(I)I)OC(Cl)(Cl)Cl.
What is the InChIKey of trichloromethyl 2,2,2-triiodoethyl carbonate?
The InChIKey is YOHBENXIHAFWHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2Cl3I3O3/c5-4(6,7)13-2(11)12-1-3(8,9)10/h1H2.
What are the key properties of trichloromethyl 2,2,2-triiodoethyl carbonate?
trichloromethyl 2,2,2-triiodoethyl carbonate has a molecular weight of 585.13 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trichloromethyl 2,2,2-triiodoethyl carbonate is sourced from PubChem (CID 89347248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).